C19H25N3O2S — CID 158075983
4-[1-[2-(2-methylpyrazol-3-yl)ethyl]spiro[2.4]heptan-2-yl]benzenesulfonamide (PubChem CID 158075983) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 4-[1-[2-(2-methylpyrazol-3-yl)ethyl]spiro[2.4]heptan-2-yl]benzenesulfonamide.
| Compound Name | 4-[1-[2-(2-methylpyrazol-3-yl)ethyl]spiro[2.4]heptan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 158075983 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-[1-[2-(2-methylpyrazol-3-yl)ethyl]spiro[2.4]heptan-2-yl]benzenesulfonamide |
| SMILES | Cn1nccc1CCC1C(c2ccc(S(N)(=O)=O)cc2)C12CCCC2 |
| InChI | InChI=1S/C19H25N3O2S/c1-22-15(10-13-21-22)6-9-17-18(19(17)11-2-3-12-19)14-4-7-16(8-5-14)25(20,23)24/h4-5,7-8,10,13,17-18H,2-3,6,9,11-12H2,1H3,(H2,20,23,24) |
| InChIKey | LLOXPQHYTFTZFT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |