C56H51ClF6N4O2 — CID 158079141
2,2-bis(3-methylphenyl)-3-phenylpropan-1-amine;2-chloropyridine;N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]pyridin-2-amine (PubChem CID 158079141) has the molecular formula C56H51ClF6N4O2 and a molecular weight of 961.49 g/mol. Its IUPAC name is 2,2-bis(3-methylphenyl)-3-phenylpropan-1-amine;2-chloropyridine;N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]pyridin-2-amine.
| Compound Name | 2,2-bis(3-methylphenyl)-3-phenylpropan-1-amine;2-chloropyridine;N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 158079141 |
| Molecular Formula | C56H51ClF6N4O2 |
| Molecular Weight | 961.49 g/mol |
| Exact Mass | 960.36 |
| IUPAC Name | 2,2-bis(3-methylphenyl)-3-phenylpropan-1-amine;2-chloropyridine;N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]pyridin-2-amine |
| SMILES | Cc1cccc(C(CN)(Cc2ccccc2)c2cccc(C)c2)c1.Clc1ccccn1.FC(F)(F)Oc1cccc(C(CNc2ccccn2)(Cc2ccccc2)c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C28H22F6N2O2.C23H25N.C5H4ClN/c29-27(30,31)37-23-12-6-10-21(16-23)26(18-20-8-2-1-3-9-20,19-36-25-14-4-5-15-35-25)22-11-7-13-24(17-22)38-28(32,33)34;1-18-8-6-12-21(14-18)23(17-24,16-20-10-4-3-5-11-20)22-13-7-9-19(2)15-22;6-5-3-1-2-4-7-5/h1-17H,18-19H2,(H,35,36);3-15H,16-17,24H2,1-2H3;1-4H |
| InChIKey | FMSRVJQWFDNHBP-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.49 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|