C18H13ClF3N3O — CID 56739499
3-chloro-N-[[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]pyridin-2-amine (PubChem CID 56739499) has the molecular formula C18H13ClF3N3O and a molecular weight of 379.77 g/mol. Its IUPAC name is 3-chloro-N-[[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]pyridin-2-amine.
| Compound Name | 3-chloro-N-[[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 56739499 |
| Molecular Formula | C18H13ClF3N3O |
| Molecular Weight | 379.77 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3-chloro-N-[[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]pyridin-2-amine |
| SMILES | FC(F)(F)c1cccc(Oc2ncccc2CNc2ncccc2Cl)c1 |
| InChI | InChI=1S/C18H13ClF3N3O/c19-15-7-3-8-23-16(15)25-11-12-4-2-9-24-17(12)26-14-6-1-5-13(10-14)18(20,21)22/h1-10H,11H2,(H,23,25) |
| InChIKey | OBFYQNWOKVFJGQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.77 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |