C39H38F4N2O7 — CID 158079596
tert-butyl 3,6-dihydro-2H-pyran-3-yl carbonate;3,6-difluoro-9H-carbazole;(3S,4R,5S)-5-(3,6-difluorocarbazol-9-yl)oxane-3,4-diol (PubChem CID 158079596) has the molecular formula C39H38F4N2O7 and a molecular weight of 722.73 g/mol. Its IUPAC name is tert-butyl 3,6-dihydro-2H-pyran-3-yl carbonate;3,6-difluoro-9H-carbazole;(3S,4R,5S)-5-(3,6-difluorocarbazol-9-yl)oxane-3,4-diol.
| Compound Name | tert-butyl 3,6-dihydro-2H-pyran-3-yl carbonate;3,6-difluoro-9H-carbazole;(3S,4R,5S)-5-(3,6-difluorocarbazol-9-yl)oxane-3,4-diol |
|---|---|
| PubChem CID | 158079596 |
| Molecular Formula | C39H38F4N2O7 |
| Molecular Weight | 722.73 g/mol |
| Exact Mass | 722.26 |
| IUPAC Name | tert-butyl 3,6-dihydro-2H-pyran-3-yl carbonate;3,6-difluoro-9H-carbazole;(3S,4R,5S)-5-(3,6-difluorocarbazol-9-yl)oxane-3,4-diol |
| SMILES | CC(C)(C)OC(=O)OC1C=CCOC1.Fc1ccc2[nH]c3ccc(F)cc3c2c1.O[C@H]1[C@@H](O)COC[C@@H]1n1c2ccc(F)cc2c2cc(F)ccc21 |
| InChI | InChI=1S/C17H15F2NO3.C12H7F2N.C10H16O4/c18-9-1-3-13-11(5-9)12-6-10(19)2-4-14(12)20(13)15-7-23-8-16(21)17(15)22;13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11;1-10(2,3)14-9(11)13-8-5-4-6-12-7-8/h1-6,15-17,21-22H,7-8H2;1-6,15H;4-5,8H,6-7H2,1-3H3/t15-,16-,17+;;/m0../s1 |
| InChIKey | FMUCULNTBUDZQZ-PXXDYJNNSA-N |
| XLogP | 7.86 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.73 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|