C24H26N2O2 — CID 158081850
methyl 3-[[3-(isoquinolin-5-ylmethyl)piperidin-1-yl]methyl]benzoate (PubChem CID 158081850) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl 3-[[3-(isoquinolin-5-ylmethyl)piperidin-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[3-(isoquinolin-5-ylmethyl)piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 158081850 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | methyl 3-[[3-(isoquinolin-5-ylmethyl)piperidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2CCCC(Cc3cccc4cnccc34)C2)c1 |
| InChI | InChI=1S/C24H26N2O2/c1-28-24(27)21-8-2-5-18(14-21)16-26-12-4-6-19(17-26)13-20-7-3-9-22-15-25-11-10-23(20)22/h2-3,5,7-11,14-15,19H,4,6,12-13,16-17H2,1H3 |
| InChIKey | FNAYXFWXPMVMGH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |