C21H22BBrFN5O4 — CID 158085312
4-bromo-2-nitro-6-pyrimidin-2-ylaniline;3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 158085312) has the molecular formula C21H22BBrFN5O4 and a molecular weight of 518.15 g/mol. Its IUPAC name is 4-bromo-2-nitro-6-pyrimidin-2-ylaniline;3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 4-bromo-2-nitro-6-pyrimidin-2-ylaniline;3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 158085312 |
| Molecular Formula | C21H22BBrFN5O4 |
| Molecular Weight | 518.15 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 4-bromo-2-nitro-6-pyrimidin-2-ylaniline;3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2cncc(F)c2)OC1(C)C.Nc1c(-c2ncccn2)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15BFNO2.C10H7BrN4O2/c1-10(2)11(3,4)16-12(15-10)8-5-9(13)7-14-6-8;11-6-4-7(10-13-2-1-3-14-10)9(12)8(5-6)15(16)17/h5-7H,1-4H3;1-5H,12H2 |
| InChIKey | FNLCWMUBDUNXRH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.15 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|