C26H26BBrN8O6 — CID 158985307
4-bromo-2-nitro-6-pyrimidin-2-ylaniline;2-nitro-6-pyrimidin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 158985307) has the molecular formula C26H26BBrN8O6 and a molecular weight of 637.26 g/mol. Its IUPAC name is 4-bromo-2-nitro-6-pyrimidin-2-ylaniline;2-nitro-6-pyrimidin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 4-bromo-2-nitro-6-pyrimidin-2-ylaniline;2-nitro-6-pyrimidin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 158985307 |
| Molecular Formula | C26H26BBrN8O6 |
| Molecular Weight | 637.26 g/mol |
| Exact Mass | 636.13 |
| IUPAC Name | 4-bromo-2-nitro-6-pyrimidin-2-ylaniline;2-nitro-6-pyrimidin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2cc(-c3ncccn3)c(N)c([N+](=O)[O-])c2)OC1(C)C.Nc1c(-c2ncccn2)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19BN4O4.C10H7BrN4O2/c1-15(2)16(3,4)25-17(24-15)10-8-11(14-19-6-5-7-20-14)13(18)12(9-10)21(22)23;11-6-4-7(10-13-2-1-3-14-10)9(12)8(5-6)15(16)17/h5-9H,18H2,1-4H3;1-5H,12H2 |
| InChIKey | JPMRFKOUMURXIC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 208.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|