About methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate
methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate (PubChem CID 158085851) has the molecular formula C29H24N4O6
and a molecular weight of 524.53 g/mol. Its IUPAC name is methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate.
Molecular Properties
| Compound Name | methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate |
| PubChem CID | 158085851 |
| Molecular Formula | C29H24N4O6 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate |
| SMILES | COC(=O)c1ccc(-n2cnc3ccccc32)cc1.COC(=O)c1ccc(Nc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12N2O2.C14H12N2O4/c1-19-15(18)11-6-8-12(9-7-11)17-10-16-13-4-2-3-5-14(13)17;1-20-14(17)10-6-8-11(9-7-10)15-12-4-2-3-5-13(12)16(18)19/h2-10H,1H3;2-9,15H,1H3 |
| InChIKey | FNMSZXGEWMBBSD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate?
The IUPAC name of methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate (CID 158085851) is methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate.
What is the SMILES notation for methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate?
The canonical SMILES for methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate is COC(=O)c1ccc(-n2cnc3ccccc32)cc1.COC(=O)c1ccc(Nc2ccccc2[N+](=O)[O-])cc1.
What is the InChIKey of methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate?
The InChIKey is FNMSZXGEWMBBSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2.C14H12N2O4/c1-19-15(18)11-6-8-12(9-7-11)17-10-16-13-4-2-3-5-14(13)17;1-20-14(17)10-6-8-11(9-7-10)15-12-4-2-3-5-13(12)16(18)19/h2-10H,1H3;2-9,15H,1H3.
What are the key properties of methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate?
methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate has a molecular weight of 524.53 g/mol, XLogP of 5.94, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(benzimidazol-1-yl)benzoate;methyl 4-(2-nitroanilino)benzoate is sourced from PubChem (CID 158085851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).