C53H41N5O7 — CID 158091007
3-N-[4-(4-aminophenoxy)phenyl]-1-N-[4-[4-[2-[3-[[4-(4-aminophenoxy)phenyl]carbamoyl]phenyl]-2-oxoethyl]phenoxy]phenyl]benzene-1,3-dicarboxamide (PubChem CID 158091007) has the molecular formula C53H41N5O7 and a molecular weight of 859.94 g/mol. Its IUPAC name is 3-N-[4-(4-aminophenoxy)phenyl]-1-N-[4-[4-[2-[3-[[4-(4-aminophenoxy)phenyl]carbamoyl]phenyl]-2-oxoethyl]phenoxy]phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-[4-(4-aminophenoxy)phenyl]-1-N-[4-[4-[2-[3-[[4-(4-aminophenoxy)phenyl]carbamoyl]phenyl]-2-oxoethyl]phenoxy]phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 158091007 |
| Molecular Formula | C53H41N5O7 |
| Molecular Weight | 859.94 g/mol |
| Exact Mass | 859.30 |
| IUPAC Name | 3-N-[4-(4-aminophenoxy)phenyl]-1-N-[4-[4-[2-[3-[[4-(4-aminophenoxy)phenyl]carbamoyl]phenyl]-2-oxoethyl]phenoxy]phenyl]benzene-1,3-dicarboxamide |
| SMILES | Nc1ccc(Oc2ccc(NC(=O)c3cccc(C(=O)Cc4ccc(Oc5ccc(NC(=O)c6cccc(C(=O)Nc7ccc(Oc8ccc(N)cc8)cc7)c6)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C53H41N5O7/c54-39-9-21-45(22-10-39)64-48-27-15-41(16-28-48)56-51(60)36-4-1-3-35(32-36)50(59)31-34-7-19-44(20-8-34)63-47-25-13-42(14-26-47)57-52(61)37-5-2-6-38(33-37)53(62)58-43-17-29-49(30-18-43)65-46-23-11-40(55)12-24-46/h1-30,32-33H,31,54-55H2,(H,56,60)(H,57,61)(H,58,62) |
| InChIKey | FOCDLILYJLBTAC-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 184.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.94 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|