C24H22N2O2 — CID 158093080
7-morpholin-4-yl-3-phenyl-9H-fluorene-1-carboxamide (PubChem CID 158093080) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 7-morpholin-4-yl-3-phenyl-9H-fluorene-1-carboxamide.
| Compound Name | 7-morpholin-4-yl-3-phenyl-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 158093080 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 7-morpholin-4-yl-3-phenyl-9H-fluorene-1-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)cc2c1Cc1cc(N3CCOCC3)ccc1-2 |
| InChI | InChI=1S/C24H22N2O2/c25-24(27)23-14-17(16-4-2-1-3-5-16)13-21-20-7-6-19(12-18(20)15-22(21)23)26-8-10-28-11-9-26/h1-7,12-14H,8-11,15H2,(H2,25,27) |
| InChIKey | FOINQFNEQQXVNF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |