C26H26ClN3O4 — CID 149115689
2-[3-chloro-4-(2-methoxyethoxy)phenyl]-7-morpholin-4-yl-5H-indeno[1,2-b]pyridine-4-carboxamide (PubChem CID 149115689) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is 2-[3-chloro-4-(2-methoxyethoxy)phenyl]-7-morpholin-4-yl-5H-indeno[1,2-b]pyridine-4-carboxamide.
| Compound Name | 2-[3-chloro-4-(2-methoxyethoxy)phenyl]-7-morpholin-4-yl-5H-indeno[1,2-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 149115689 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-[3-chloro-4-(2-methoxyethoxy)phenyl]-7-morpholin-4-yl-5H-indeno[1,2-b]pyridine-4-carboxamide |
| SMILES | COCCOc1ccc(-c2cc(C(N)=O)c3c(n2)-c2ccc(N4CCOCC4)cc2C3)cc1Cl |
| InChI | InChI=1S/C26H26ClN3O4/c1-32-10-11-34-24-5-2-16(14-22(24)27)23-15-21(26(28)31)20-13-17-12-18(30-6-8-33-9-7-30)3-4-19(17)25(20)29-23/h2-5,12,14-15H,6-11,13H2,1H3,(H2,28,31) |
| InChIKey | QYIBADWMKNMQFE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|