C25H23BClN3O3 — CID 89054149
CID 89054149 (PubChem CID 89054149) has the molecular formula C25H23BClN3O3 and a molecular weight of 459.74 g/mol.
| Compound Name | CID 89054149 |
|---|---|
| PubChem CID | 89054149 |
| Molecular Formula | C25H23BClN3O3 |
| Molecular Weight | 459.74 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | — |
| SMILES | [B]CCOc1ccc(-c2cc(C(N)=O)c3[nH]c4cc(N5CCOCC5)ccc4c3c2)cc1Cl |
| InChI | InChI=1S/C25H23BClN3O3/c26-5-8-33-23-4-1-15(13-21(23)27)16-11-19-18-3-2-17(30-6-9-32-10-7-30)14-22(18)29-24(19)20(12-16)25(28)31/h1-4,11-14,29H,5-10H2,(H2,28,31) |
| InChIKey | SGIAJJCMCCYUME-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.74 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|