C35H32F6N6O6 — CID 158095530
2-(5-azido-6-methyl-3-pyridinyl)-1-[3-(trifluoromethoxy)phenyl]ethanone;tert-butyl N-[2-methyl-5-[2-oxo-2-[3-(trifluoromethoxy)phenyl]ethyl]-3-pyridinyl]carbamate (PubChem CID 158095530) has the molecular formula C35H32F6N6O6 and a molecular weight of 746.67 g/mol. Its IUPAC name is 2-(5-azido-6-methyl-3-pyridinyl)-1-[3-(trifluoromethoxy)phenyl]ethanone;tert-butyl N-[2-methyl-5-[2-oxo-2-[3-(trifluoromethoxy)phenyl]ethyl]-3-pyridinyl]carbamate.
| Compound Name | 2-(5-azido-6-methyl-3-pyridinyl)-1-[3-(trifluoromethoxy)phenyl]ethanone;tert-butyl N-[2-methyl-5-[2-oxo-2-[3-(trifluoromethoxy)phenyl]ethyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 158095530 |
| Molecular Formula | C35H32F6N6O6 |
| Molecular Weight | 746.67 g/mol |
| Exact Mass | 746.23 |
| IUPAC Name | 2-(5-azido-6-methyl-3-pyridinyl)-1-[3-(trifluoromethoxy)phenyl]ethanone;tert-butyl N-[2-methyl-5-[2-oxo-2-[3-(trifluoromethoxy)phenyl]ethyl]-3-pyridinyl]carbamate |
| SMILES | Cc1ncc(CC(=O)c2cccc(OC(F)(F)F)c2)cc1N=[N+]=[N-].Cc1ncc(CC(=O)c2cccc(OC(F)(F)F)c2)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H21F3N2O4.C15H11F3N4O2/c1-12-16(25-18(27)29-19(2,3)4)8-13(11-24-12)9-17(26)14-6-5-7-15(10-14)28-20(21,22)23;1-9-13(21-22-19)5-10(8-20-9)6-14(23)11-3-2-4-12(7-11)24-15(16,17)18/h5-8,10-11H,9H2,1-4H3,(H,25,27);2-5,7-8H,6H2,1H3 |
| InChIKey | FOPRMIVAKCPEGL-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 165.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.67 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|