C35H56N6O9 — CID 158096506
bis(tert-butyl 4-but-2-ynyl-3-oxopiperazine-1-carboxylate);tert-butyl 3-oxopiperazine-1-carboxylate (PubChem CID 158096506) has the molecular formula C35H56N6O9 and a molecular weight of 704.87 g/mol. Its IUPAC name is bis(tert-butyl 4-but-2-ynyl-3-oxopiperazine-1-carboxylate);tert-butyl 3-oxopiperazine-1-carboxylate.
| Compound Name | bis(tert-butyl 4-but-2-ynyl-3-oxopiperazine-1-carboxylate);tert-butyl 3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 158096506 |
| Molecular Formula | C35H56N6O9 |
| Molecular Weight | 704.87 g/mol |
| Exact Mass | 704.41 |
| IUPAC Name | bis(tert-butyl 4-but-2-ynyl-3-oxopiperazine-1-carboxylate);tert-butyl 3-oxopiperazine-1-carboxylate |
| SMILES | CC#CCN1CCN(C(=O)OC(C)(C)C)CC1=O.CC#CCN1CCN(C(=O)OC(C)(C)C)CC1=O.CC(C)(C)OC(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/2C13H20N2O3.C9H16N2O3/c2*1-5-6-7-14-8-9-15(10-11(14)16)12(17)18-13(2,3)4;1-9(2,3)14-8(13)11-5-4-10-7(12)6-11/h2*7-10H2,1-4H3;4-6H2,1-3H3,(H,10,12) |
| InChIKey | FOSRJLOSUMUYRV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 158.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.87 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|