C23H42N4O9 — CID 157297779
tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 3-oxopiperazine-1-carboxylate;piperazin-2-one (PubChem CID 157297779) has the molecular formula C23H42N4O9 and a molecular weight of 518.61 g/mol. Its IUPAC name is tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 3-oxopiperazine-1-carboxylate;piperazin-2-one.
| Compound Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 3-oxopiperazine-1-carboxylate;piperazin-2-one |
|---|---|
| PubChem CID | 157297779 |
| Molecular Formula | C23H42N4O9 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 3-oxopiperazine-1-carboxylate;piperazin-2-one |
| SMILES | CC(C)(C)OC(=O)N1CCNC(=O)C1.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=C1CNCCN1 |
| InChI | InChI=1S/C10H18O5.C9H16N2O3.C4H8N2O/c1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;1-9(2,3)14-8(13)11-5-4-10-7(12)6-11;7-4-3-5-1-2-6-4/h1-6H3;4-6H2,1-3H3,(H,10,12);5H,1-3H2,(H,6,7) |
| InChIKey | BBNRJMUJBKEIAY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|