C29H52N8O9 — CID 58734961
[(2-methylpropan-2-yl)oxycarbonylamino] 4-[3-[[2-[3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]piperazin-1-yl]propylamino]-2-oxoacetyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 58734961) has the molecular formula C29H52N8O9 and a molecular weight of 656.78 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonylamino] 4-[3-[[2-[3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]piperazin-1-yl]propylamino]-2-oxoacetyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | [(2-methylpropan-2-yl)oxycarbonylamino] 4-[3-[[2-[3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]piperazin-1-yl]propylamino]-2-oxoacetyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58734961 |
| Molecular Formula | C29H52N8O9 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonylamino] 4-[3-[[2-[3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]piperazin-1-yl]propylamino]-2-oxoacetyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCN(CCCNC(=O)C(=O)NCCCN2CCN(C(=O)ONC(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C29H52N8O9/c1-28(2,3)44-25(41)32-21-22(38)36-17-13-34(14-18-36)11-7-9-30-23(39)24(40)31-10-8-12-35-15-19-37(20-16-35)27(43)46-33-26(42)45-29(4,5)6/h7-21H2,1-6H3,(H,30,39)(H,31,40)(H,32,41)(H,33,42) |
| InChIKey | SZZPBKAAKPCRBB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 191.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|