About tert-butyl piperazine-1-carboxylate
tert-butyl piperazine-1-carboxylate (PubChem CID 66735026) has the molecular formula C18H36N4O4
and a molecular weight of 372.51 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl piperazine-1-carboxylate |
| PubChem CID | 66735026 |
| Molecular Formula | C18H36N4O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.CC(C)(C)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/2C9H18N2O2/c2*1-9(2,3)13-8(12)11-6-4-10-5-7-11/h2*10H,4-7H2,1-3H3 |
| InChIKey | GCSSSCOWYZYEFZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl piperazine-1-carboxylate?
The IUPAC name of tert-butyl piperazine-1-carboxylate (CID 66735026) is tert-butyl piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl piperazine-1-carboxylate?
The canonical SMILES for tert-butyl piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCNCC1.CC(C)(C)OC(=O)N1CCNCC1.
What is the InChIKey of tert-butyl piperazine-1-carboxylate?
The InChIKey is GCSSSCOWYZYEFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H18N2O2/c2*1-9(2,3)13-8(12)11-6-4-10-5-7-11/h2*10H,4-7H2,1-3H3.
What are the key properties of tert-butyl piperazine-1-carboxylate?
tert-butyl piperazine-1-carboxylate has a molecular weight of 372.51 g/mol, XLogP of 1.65, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl piperazine-1-carboxylate is sourced from PubChem (CID 66735026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).