C21H27N3O4 — CID 158096563
benzyl (2S,5R)-2,5-diamino-6-[1-(4-hydroxyphenyl)ethylamino]-6-oxohexanoate (PubChem CID 158096563) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is benzyl (2S,5R)-2,5-diamino-6-[1-(4-hydroxyphenyl)ethylamino]-6-oxohexanoate.
| Compound Name | benzyl (2S,5R)-2,5-diamino-6-[1-(4-hydroxyphenyl)ethylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 158096563 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | benzyl (2S,5R)-2,5-diamino-6-[1-(4-hydroxyphenyl)ethylamino]-6-oxohexanoate |
| SMILES | CC(NC(=O)[C@H](N)CC[C@H](N)C(=O)OCc1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-14(16-7-9-17(25)10-8-16)24-20(26)18(22)11-12-19(23)21(27)28-13-15-5-3-2-4-6-15/h2-10,14,18-19,25H,11-13,22-23H2,1H3,(H,24,26)/t14?,18-,19+/m1/s1 |
| InChIKey | WZUCHXRQVQLHNQ-BRQZFJGMSA-N |
| XLogP | 1.75 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |