About methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene
methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene (PubChem CID 158098146) has the molecular formula C27H35NO3
and a molecular weight of 421.58 g/mol. Its IUPAC name is methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene.
Molecular Properties
| Compound Name | methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene |
| PubChem CID | 158098146 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene |
| SMILES | C.CC(C)c1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1.Cc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C16H17NO3.C10H14.CH4/c1-12(2)14-5-9-16(10-6-14)20-11-13-3-7-15(8-4-13)17(18)19;1-8(2)10-6-4-5-9(3)7-10;/h3-10,12H,11H2,1-2H3;4-8H,1-3H3;1H4 |
| InChIKey | FOXMQQMIGPNBJZ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene?
The IUPAC name of methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene (CID 158098146) is methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene.
What is the SMILES notation for methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene?
The canonical SMILES for methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene is C.CC(C)c1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1.Cc1cccc(C(C)C)c1.
What is the InChIKey of methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene?
The InChIKey is FOXMQQMIGPNBJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3.C10H14.CH4/c1-12(2)14-5-9-16(10-6-14)20-11-13-3-7-15(8-4-13)17(18)19;1-8(2)10-6-4-5-9(3)7-10;/h3-10,12H,11H2,1-2H3;4-8H,1-3H3;1H4.
What are the key properties of methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene?
methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene has a molecular weight of 421.58 g/mol, XLogP of 8.05, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-3-propan-2-ylbenzene;1-nitro-4-[(4-propan-2-ylphenoxy)methyl]benzene is sourced from PubChem (CID 158098146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).