C11H24O4S2 — CID 158102219
2,2-dimethylpropyl (3S)-3-methyl-4-(sulfanylmethoxy)butane-1-sulfonate (PubChem CID 158102219) has the molecular formula C11H24O4S2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 2,2-dimethylpropyl (3S)-3-methyl-4-(sulfanylmethoxy)butane-1-sulfonate.
| Compound Name | 2,2-dimethylpropyl (3S)-3-methyl-4-(sulfanylmethoxy)butane-1-sulfonate |
|---|---|
| PubChem CID | 158102219 |
| Molecular Formula | C11H24O4S2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2,2-dimethylpropyl (3S)-3-methyl-4-(sulfanylmethoxy)butane-1-sulfonate |
| SMILES | C[C@@H](CCS(=O)(=O)OCC(C)(C)C)COCS |
| InChI | InChI=1S/C11H24O4S2/c1-10(7-14-9-16)5-6-17(12,13)15-8-11(2,3)4/h10,16H,5-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | FPKDVZCQDLIUJM-JTQLQIEISA-N |
| XLogP | 2.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|