C34H34N4O2 — CID 158104112
4-[6-[2-[4-[3-(dimethylamino)propoxy]-3-methylphenyl]-3H-benzimidazol-5-yl]-3H-indol-2-yl]-2-methylphenol (PubChem CID 158104112) has the molecular formula C34H34N4O2 and a molecular weight of 530.67 g/mol. Its IUPAC name is 4-[6-[2-[4-[3-(dimethylamino)propoxy]-3-methylphenyl]-3H-benzimidazol-5-yl]-3H-indol-2-yl]-2-methylphenol.
| Compound Name | 4-[6-[2-[4-[3-(dimethylamino)propoxy]-3-methylphenyl]-3H-benzimidazol-5-yl]-3H-indol-2-yl]-2-methylphenol |
|---|---|
| PubChem CID | 158104112 |
| Molecular Formula | C34H34N4O2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 4-[6-[2-[4-[3-(dimethylamino)propoxy]-3-methylphenyl]-3H-benzimidazol-5-yl]-3H-indol-2-yl]-2-methylphenol |
| SMILES | Cc1cc(C2=Nc3cc(-c4ccc5nc(-c6ccc(OCCCN(C)C)c(C)c6)[nH]c5c4)ccc3C2)ccc1O |
| InChI | InChI=1S/C34H34N4O2/c1-21-16-25(9-12-32(21)39)30-20-26-7-6-23(18-29(26)35-30)24-8-11-28-31(19-24)37-34(36-28)27-10-13-33(22(2)17-27)40-15-5-14-38(3)4/h6-13,16-19,39H,5,14-15,20H2,1-4H3,(H,36,37) |
| InChIKey | FPPVHVNAUAAPOS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|