C16H21FN4O3 — CID 158104892
ethyl formate;5-(3-fluorophenyl)-3-(piperazin-1-ylmethyl)-1,2,4-oxadiazole (PubChem CID 158104892) has the molecular formula C16H21FN4O3 and a molecular weight of 336.37 g/mol. Its IUPAC name is ethyl formate;5-(3-fluorophenyl)-3-(piperazin-1-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | ethyl formate;5-(3-fluorophenyl)-3-(piperazin-1-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 158104892 |
| Molecular Formula | C16H21FN4O3 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | ethyl formate;5-(3-fluorophenyl)-3-(piperazin-1-ylmethyl)-1,2,4-oxadiazole |
| SMILES | CCOC=O.Fc1cccc(-c2nc(CN3CCNCC3)no2)c1 |
| InChI | InChI=1S/C13H15FN4O.C3H6O2/c14-11-3-1-2-10(8-11)13-16-12(17-19-13)9-18-6-4-15-5-7-18;1-2-5-3-4/h1-3,8,15H,4-7,9H2;3H,2H2,1H3 |
| InChIKey | FPSFJOMGHANZRY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|