C13H16FN2O4P — CID 86661559
3-(diethoxyphosphorylmethyl)-5-(3-fluorophenyl)-1,2,4-oxadiazole (PubChem CID 86661559) has the molecular formula C13H16FN2O4P and a molecular weight of 314.25 g/mol. Its IUPAC name is 3-(diethoxyphosphorylmethyl)-5-(3-fluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(diethoxyphosphorylmethyl)-5-(3-fluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 86661559 |
| Molecular Formula | C13H16FN2O4P |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-(diethoxyphosphorylmethyl)-5-(3-fluorophenyl)-1,2,4-oxadiazole |
| SMILES | CCOP(=O)(Cc1noc(-c2cccc(F)c2)n1)OCC |
| InChI | InChI=1S/C13H16FN2O4P/c1-3-18-21(17,19-4-2)9-12-15-13(20-16-12)10-6-5-7-11(14)8-10/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | ZLJYPCAVMGIBSY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|