C23H26ClN3O3S — CID 158104997
1-(3-chloro-4-methylphenyl)-3-[[5-[(1S)-4-methylidene-2-oxocycloheptyl]-6-oxo-1,4-dihydrothieno[3,4-c]pyrrol-2-yl]methyl]urea (PubChem CID 158104997) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[[5-[(1S)-4-methylidene-2-oxocycloheptyl]-6-oxo-1,4-dihydrothieno[3,4-c]pyrrol-2-yl]methyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[[5-[(1S)-4-methylidene-2-oxocycloheptyl]-6-oxo-1,4-dihydrothieno[3,4-c]pyrrol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 158104997 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[5-[(1S)-4-methylidene-2-oxocycloheptyl]-6-oxo-1,4-dihydrothieno[3,4-c]pyrrol-2-yl]methyl]urea |
| SMILES | C=C1CCC[C@H](N2CC3=C(CS(CNC(=O)Nc4ccc(C)c(Cl)c4)=C3)C2=O)C(=O)C1 |
| InChI | InChI=1S/C23H26ClN3O3S/c1-14-4-3-5-20(21(28)8-14)27-10-16-11-31(12-18(16)22(27)29)13-25-23(30)26-17-7-6-15(2)19(24)9-17/h6-7,9,11,20H,1,3-5,8,10,12-13H2,2H3,(H2,25,26,30)/t20-,31?/m0/s1 |
| InChIKey | BIEOSFQHXAQIDY-MFYZJFEASA-N |
| XLogP | 4.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|