C8H16F2O2Si — CID 158106213
[2,2-difluoroethyl(diethyl)silyl] acetate (PubChem CID 158106213) has the molecular formula C8H16F2O2Si and a molecular weight of 210.30 g/mol. Its IUPAC name is [2,2-difluoroethyl(diethyl)silyl] acetate.
| Compound Name | [2,2-difluoroethyl(diethyl)silyl] acetate |
|---|---|
| PubChem CID | 158106213 |
| Molecular Formula | C8H16F2O2Si |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | [2,2-difluoroethyl(diethyl)silyl] acetate |
| SMILES | CC[Si](CC)(CC(F)F)OC(C)=O |
| InChI | InChI=1S/C8H16F2O2Si/c1-4-13(5-2,6-8(9)10)12-7(3)11/h8H,4-6H2,1-3H3 |
| InChIKey | FPWCGPUQTGSTOB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|