About 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea
1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea (PubChem CID 158106249) has the molecular formula C29H31N3OS2
and a molecular weight of 501.72 g/mol. Its IUPAC name is 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea.
Molecular Properties
| Compound Name | 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea |
| PubChem CID | 158106249 |
| Molecular Formula | C29H31N3OS2 |
| Molecular Weight | 501.72 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea |
| SMILES | C=C(N)SC(c1ccccc1)c1ccccc1.NC(N)=S.OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15NS.C13H12O.CH4N2S/c1-12(16)17-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1(3)4/h2-11,15H,1,16H2;1-10,13-14H;(H4,2,3,4) |
| InChIKey | FPWGMAJDUVWPLO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.72 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea?
The IUPAC name of 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea (CID 158106249) is 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea.
What is the SMILES notation for 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea?
The canonical SMILES for 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea is C=C(N)SC(c1ccccc1)c1ccccc1.NC(N)=S.OC(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea?
The InChIKey is FPWGMAJDUVWPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NS.C13H12O.CH4N2S/c1-12(16)17-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1(3)4/h2-11,15H,1,16H2;1-10,13-14H;(H4,2,3,4).
What are the key properties of 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea?
1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea has a molecular weight of 501.72 g/mol, XLogP of 5.90, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydrylsulfanylethenamine;diphenylmethanol;thiourea is sourced from PubChem (CID 158106249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).