C30H36N2O3S — CID 158106707
(2S)-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-4-oxo-N-[(2R)-5-oxo-1-phenylhept-6-en-2-yl]heptanamide (PubChem CID 158106707) has the molecular formula C30H36N2O3S and a molecular weight of 504.70 g/mol. Its IUPAC name is (2S)-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-4-oxo-N-[(2R)-5-oxo-1-phenylhept-6-en-2-yl]heptanamide.
| Compound Name | (2S)-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-4-oxo-N-[(2R)-5-oxo-1-phenylhept-6-en-2-yl]heptanamide |
|---|---|
| PubChem CID | 158106707 |
| Molecular Formula | C30H36N2O3S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | (2S)-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-4-oxo-N-[(2R)-5-oxo-1-phenylhept-6-en-2-yl]heptanamide |
| SMILES | C=CC(=O)CC[C@H](Cc1ccccc1)NC(=O)[C@@H](CC(=O)CCC)Cc1nc2ccc(CC)cc2s1 |
| InChI | InChI=1S/C30H36N2O3S/c1-4-10-26(34)19-23(20-29-32-27-16-13-21(5-2)18-28(27)36-29)30(35)31-24(14-15-25(33)6-3)17-22-11-8-7-9-12-22/h6-9,11-13,16,18,23-24H,3-5,10,14-15,17,19-20H2,1-2H3,(H,31,35)/t23-,24+/m0/s1 |
| InChIKey | VERVQCBQJIPSLQ-BJKOFHAPSA-N |
| XLogP | 6.04 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|