C36H53N3O3S — CID 157363348
(2S)-N-[(E,2R)-1-cyclohexyl-5-oxo-8-piperidin-1-yloct-6-en-2-yl]-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-4-oxoheptanamide (PubChem CID 157363348) has the molecular formula C36H53N3O3S and a molecular weight of 607.91 g/mol. Its IUPAC name is (2S)-N-[(E,2R)-1-cyclohexyl-5-oxo-8-piperidin-1-yloct-6-en-2-yl]-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-4-oxoheptanamide.
| Compound Name | (2S)-N-[(E,2R)-1-cyclohexyl-5-oxo-8-piperidin-1-yloct-6-en-2-yl]-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-4-oxoheptanamide |
|---|---|
| PubChem CID | 157363348 |
| Molecular Formula | C36H53N3O3S |
| Molecular Weight | 607.91 g/mol |
| Exact Mass | 607.38 |
| IUPAC Name | (2S)-N-[(E,2R)-1-cyclohexyl-5-oxo-8-piperidin-1-yloct-6-en-2-yl]-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-4-oxoheptanamide |
| SMILES | CCCC(=O)C[C@@H](Cc1nc2ccc(CC)cc2s1)C(=O)N[C@H](CCC(=O)/C=C/CN1CCCCC1)CC1CCCCC1 |
| InChI | InChI=1S/C36H53N3O3S/c1-3-12-32(41)25-29(26-35-38-33-19-16-27(4-2)24-34(33)43-35)36(42)37-30(23-28-13-7-5-8-14-28)17-18-31(40)15-11-22-39-20-9-6-10-21-39/h11,15-16,19,24,28-30H,3-10,12-14,17-18,20-23,25-26H2,1-2H3,(H,37,42)/b15-11+/t29-,30+/m0/s1 |
| InChIKey | AGKOMWHQBSQTCY-KVQQFGJTSA-N |
| XLogP | 7.62 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.91 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|