C33H46ClN3O3S — CID 161487875
(2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(E,2R)-1-cyclohexyl-5-oxo-8-piperidin-1-yloct-6-en-2-yl]-4-oxohexanamide (PubChem CID 161487875) has the molecular formula C33H46ClN3O3S and a molecular weight of 600.27 g/mol. Its IUPAC name is (2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(E,2R)-1-cyclohexyl-5-oxo-8-piperidin-1-yloct-6-en-2-yl]-4-oxohexanamide.
| Compound Name | (2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(E,2R)-1-cyclohexyl-5-oxo-8-piperidin-1-yloct-6-en-2-yl]-4-oxohexanamide |
|---|---|
| PubChem CID | 161487875 |
| Molecular Formula | C33H46ClN3O3S |
| Molecular Weight | 600.27 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | (2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(E,2R)-1-cyclohexyl-5-oxo-8-piperidin-1-yloct-6-en-2-yl]-4-oxohexanamide |
| SMILES | CCC(=O)CC(Cc1nc2ccc(Cl)cc2s1)C(=O)N[C@H](CCC(=O)/C=C/CN1CCCCC1)CC1CCCCC1 |
| InChI | InChI=1S/C33H46ClN3O3S/c1-2-28(38)21-25(22-32-36-30-16-13-26(34)23-31(30)41-32)33(40)35-27(20-24-10-5-3-6-11-24)14-15-29(39)12-9-19-37-17-7-4-8-18-37/h9,12-13,16,23-25,27H,2-8,10-11,14-15,17-22H2,1H3,(H,35,40)/b12-9+/t25?,27-/m1/s1 |
| InChIKey | HFRPMHRTNFAPFO-MKORCZJESA-N |
| XLogP | 7.32 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.27 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|