C27H30N4O4 — CID 158107348
3-(5-isocyano-2-methoxyphenyl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid (PubChem CID 158107348) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-(5-isocyano-2-methoxyphenyl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid.
| Compound Name | 3-(5-isocyano-2-methoxyphenyl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 158107348 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 3-(5-isocyano-2-methoxyphenyl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid |
| SMILES | [C-]#[N+]c1ccc(OC)c(C(CC(=O)O)Cc2cc(OCCc3ccc4c(n3)CCCC4)n(C)n2)c1 |
| InChI | InChI=1S/C27H30N4O4/c1-28-21-10-11-25(34-3)23(16-21)19(15-27(32)33)14-22-17-26(31(2)30-22)35-13-12-20-9-8-18-6-4-5-7-24(18)29-20/h8-11,16-17,19H,4-7,12-15H2,2-3H3,(H,32,33) |
| InChIKey | FPZSIJIXPKXJMD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|