C30H36F3N3O3 — CID 162091168
4-[1-methyl-5-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethoxy]pyrazol-3-yl]-3-[3-methyl-5-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]butanoic acid (PubChem CID 162091168) has the molecular formula C30H36F3N3O3 and a molecular weight of 543.63 g/mol. Its IUPAC name is 4-[1-methyl-5-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethoxy]pyrazol-3-yl]-3-[3-methyl-5-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]butanoic acid.
| Compound Name | 4-[1-methyl-5-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethoxy]pyrazol-3-yl]-3-[3-methyl-5-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 162091168 |
| Molecular Formula | C30H36F3N3O3 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 4-[1-methyl-5-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethoxy]pyrazol-3-yl]-3-[3-methyl-5-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]butanoic acid |
| SMILES | Cc1cc(C(CC(=O)O)Cc2cc(OCCc3ccc4c(n3)CCCC4)n(C)n2)cc(C(C)(C)C(F)(F)F)c1 |
| InChI | InChI=1S/C30H36F3N3O3/c1-19-13-21(15-23(14-19)29(2,3)30(31,32)33)22(17-28(37)38)16-25-18-27(36(4)35-25)39-12-11-24-10-9-20-7-5-6-8-26(20)34-24/h9-10,13-15,18,22H,5-8,11-12,16-17H2,1-4H3,(H,37,38) |
| InChIKey | ZDQAHGDWJZXNJD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |