C15H11F3N2O — CID 158108399
4-(5-methoxy-3-pyridinyl)-6-(trifluoromethyl)-1H-isoindole (PubChem CID 158108399) has the molecular formula C15H11F3N2O and a molecular weight of 292.26 g/mol. Its IUPAC name is 4-(5-methoxy-3-pyridinyl)-6-(trifluoromethyl)-1H-isoindole.
| Compound Name | 4-(5-methoxy-3-pyridinyl)-6-(trifluoromethyl)-1H-isoindole |
|---|---|
| PubChem CID | 158108399 |
| Molecular Formula | C15H11F3N2O |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-(5-methoxy-3-pyridinyl)-6-(trifluoromethyl)-1H-isoindole |
| SMILES | COc1cncc(-c2cc(C(F)(F)F)cc3c2C=NC3)c1 |
| InChI | InChI=1S/C15H11F3N2O/c1-21-12-3-10(6-19-7-12)13-4-11(15(16,17)18)2-9-5-20-8-14(9)13/h2-4,6-8H,5H2,1H3 |
| InChIKey | FQCSMDKZVIYNBM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |