About tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate
tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate (PubChem CID 158111470) has the molecular formula C23H45AlO5
and a molecular weight of 428.59 g/mol. Its IUPAC name is tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate.
Molecular Properties
| Compound Name | tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate |
| PubChem CID | 158111470 |
| Molecular Formula | C23H45AlO5 |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate |
| SMILES | CCCCCCCCCCCCCOC(=O)/C=C(\C)O[Al](OC(C)C)OC(C)C |
| InChI | InChI=1S/C17H32O3.2C3H7O.Al/c1-3-4-5-6-7-8-9-10-11-12-13-14-20-17(19)15-16(2)18;2*1-3(2)4;/h15,18H,3-14H2,1-2H3;2*3H,1-2H3;/q;2*-1;+3/p-1/b16-15+;;; |
| InChIKey | FQMIPPRBUAMWIE-MOJNZBSRSA-M |
| XLogP | 6.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate?
The IUPAC name of tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate (CID 158111470) is tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate.
What is the SMILES notation for tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate?
The canonical SMILES for tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate is CCCCCCCCCCCCCOC(=O)/C=C(\C)O[Al](OC(C)C)OC(C)C.
What is the InChIKey of tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate?
The InChIKey is FQMIPPRBUAMWIE-MOJNZBSRSA-M. The full InChI is InChI=1S/C17H32O3.2C3H7O.Al/c1-3-4-5-6-7-8-9-10-11-12-13-14-20-17(19)15-16(2)18;2*1-3(2)4;/h15,18H,3-14H2,1-2H3;2*3H,1-2H3;/q;2*-1;+3/p-1/b16-15+;;;.
What are the key properties of tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate?
tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate has a molecular weight of 428.59 g/mol, XLogP of 6.60, 19 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tridecyl (E)-3-di(propan-2-yloxy)alumanyloxybut-2-enoate is sourced from PubChem (CID 158111470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).