C27H20ClF6NO5 — CID 158113890
4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-2-oxo-4-[2-(trifluoromethyl)cyclopropyl]butyl]benzoic acid (PubChem CID 158113890) has the molecular formula C27H20ClF6NO5 and a molecular weight of 587.90 g/mol. Its IUPAC name is 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-2-oxo-4-[2-(trifluoromethyl)cyclopropyl]butyl]benzoic acid.
| Compound Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-2-oxo-4-[2-(trifluoromethyl)cyclopropyl]butyl]benzoic acid |
|---|---|
| PubChem CID | 158113890 |
| Molecular Formula | C27H20ClF6NO5 |
| Molecular Weight | 587.90 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-2-oxo-4-[2-(trifluoromethyl)cyclopropyl]butyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC(=O)C(CC2CC2C(F)(F)F)c2ccc(-c3c(OC(F)F)ccc(Cl)c3F)c[n+]2[O-])cc1 |
| InChI | InChI=1S/C27H20ClF6NO5/c28-19-6-8-22(40-26(30)31)23(24(19)29)15-5-7-20(35(39)12-15)17(10-16-11-18(16)27(32,33)34)21(36)9-13-1-3-14(4-2-13)25(37)38/h1-8,12,16-18,26H,9-11H2,(H,37,38) |
| InChIKey | FQTOGYRRHJOYJH-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.90 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|