C18H38CoN2O2 — CID 158115206
cobalt;bis(N,N-di(propan-2-yl)propanamide) (PubChem CID 158115206) has the molecular formula C18H38CoN2O2 and a molecular weight of 373.45 g/mol. Its IUPAC name is cobalt;bis(N,N-di(propan-2-yl)propanamide).
| Compound Name | cobalt;bis(N,N-di(propan-2-yl)propanamide) |
|---|---|
| PubChem CID | 158115206 |
| Molecular Formula | C18H38CoN2O2 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | cobalt;bis(N,N-di(propan-2-yl)propanamide) |
| SMILES | CCC(=O)N(C(C)C)C(C)C.CCC(=O)N(C(C)C)C(C)C.[Co] |
| InChI | InChI=1S/2C9H19NO.Co/c2*1-6-9(11)10(7(2)3)8(4)5;/h2*7-8H,6H2,1-5H3; |
| InChIKey | FQXLIJJGNDDGCI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |