C27H25N3O3S2 — CID 158120212
4-[(2R)-4-[5-cyclopropyl-2-[5-(4-methylphenyl)-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide (PubChem CID 158120212) has the molecular formula C27H25N3O3S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is 4-[(2R)-4-[5-cyclopropyl-2-[5-(4-methylphenyl)-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide.
| Compound Name | 4-[(2R)-4-[5-cyclopropyl-2-[5-(4-methylphenyl)-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 158120212 |
| Molecular Formula | C27H25N3O3S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 4-[(2R)-4-[5-cyclopropyl-2-[5-(4-methylphenyl)-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide |
| SMILES | Cc1ccc(-c2cnc(-c3nc(C(=O)C[C@@H](C)c4ccc(C(=O)NO)cc4)c(C4CC4)s3)s2)cc1 |
| InChI | InChI=1S/C27H25N3O3S2/c1-15-3-5-18(6-4-15)22-14-28-26(34-22)27-29-23(24(35-27)19-9-10-19)21(31)13-16(2)17-7-11-20(12-8-17)25(32)30-33/h3-8,11-12,14,16,19,33H,9-10,13H2,1-2H3,(H,30,32)/t16-/m1/s1 |
| InChIKey | FRNAOBYWRJOLBD-MRXNPFEDSA-N |
| XLogP | 6.61 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|