C19H20BCl2F3N4O2 — CID 158120235
4,6-dichloropyrimidine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethyl)indazole (PubChem CID 158120235) has the molecular formula C19H20BCl2F3N4O2 and a molecular weight of 475.11 g/mol. Its IUPAC name is 4,6-dichloropyrimidine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethyl)indazole.
| Compound Name | 4,6-dichloropyrimidine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 158120235 |
| Molecular Formula | C19H20BCl2F3N4O2 |
| Molecular Weight | 475.11 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 4,6-dichloropyrimidine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethyl)indazole |
| SMILES | Clc1cc(Cl)ncn1.Cn1ncc2cc(B3OC(C)(C)C(C)(C)O3)cc(C(F)(F)F)c21 |
| InChI | InChI=1S/C15H18BF3N2O2.C4H2Cl2N2/c1-13(2)14(3,4)23-16(22-13)10-6-9-8-20-21(5)12(9)11(7-10)15(17,18)19;5-3-1-4(6)8-2-7-3/h6-8H,1-5H3;1-2H |
| InChIKey | FRNCLZJWPAKXRJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.11 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|