About [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform
[5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform (PubChem CID 158121624) has the molecular formula C25H22F3OS3+
and a molecular weight of 491.65 g/mol. Its IUPAC name is [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform.
Molecular Properties
| Compound Name | [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform |
| PubChem CID | 158121624 |
| Molecular Formula | C25H22F3OS3+ |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform |
| SMILES | CC(=O)c1ccc(Sc2ccc([SH2+])s2)cc1.FC(F)F.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10OS3.C12H10.CHF3/c1-8(13)9-2-4-10(5-3-9)15-12-7-6-11(14)16-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1(3)4/h2-7,14H,1H3;1-10H;1H/p+1 |
| InChIKey | FRRFAZNMBGHUPN-UHFFFAOYSA-O |
| XLogP | 8.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform?
The IUPAC name of [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform (CID 158121624) is [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform.
What is the SMILES notation for [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform?
The canonical SMILES for [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform is CC(=O)c1ccc(Sc2ccc([SH2+])s2)cc1.FC(F)F.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform?
The InChIKey is FRRFAZNMBGHUPN-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H10OS3.C12H10.CHF3/c1-8(13)9-2-4-10(5-3-9)15-12-7-6-11(14)16-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1(3)4/h2-7,14H,1H3;1-10H;1H/p+1.
What are the key properties of [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform?
[5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform has a molecular weight of 491.65 g/mol, XLogP of 8.00, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform is sourced from PubChem (CID 158121624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).