C25H22F3OS3+ — CID 158121624
[5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform (PubChem CID 158121624) has the molecular formula C25H22F3OS3+ and a molecular weight of 491.65 g/mol. Its IUPAC name is [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform.
| Compound Name | [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform |
|---|---|
| PubChem CID | 158121624 |
| Molecular Formula | C25H22F3OS3+ |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | [5-(4-acetylphenyl)sulfanylthiophen-2-yl]sulfanium;1,1'-biphenyl;fluoroform |
| SMILES | CC(=O)c1ccc(Sc2ccc([SH2+])s2)cc1.FC(F)F.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10OS3.C12H10.CHF3/c1-8(13)9-2-4-10(5-3-9)15-12-7-6-11(14)16-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1(3)4/h2-7,14H,1H3;1-10H;1H/p+1 |
| InChIKey | FRRFAZNMBGHUPN-UHFFFAOYSA-O |
| XLogP | 8.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|