C18H20O8 — CID 158122104
2-hydroxy-2-phenoxypropanoic acid;2-(4-hydroxyphenoxy)propanoic acid (PubChem CID 158122104) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is 2-hydroxy-2-phenoxypropanoic acid;2-(4-hydroxyphenoxy)propanoic acid.
| Compound Name | 2-hydroxy-2-phenoxypropanoic acid;2-(4-hydroxyphenoxy)propanoic acid |
|---|---|
| PubChem CID | 158122104 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-hydroxy-2-phenoxypropanoic acid;2-(4-hydroxyphenoxy)propanoic acid |
| SMILES | CC(O)(Oc1ccccc1)C(=O)O.CC(Oc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/2C9H10O4/c1-6(9(11)12)13-8-4-2-7(10)3-5-8;1-9(12,8(10)11)13-7-5-3-2-4-6-7/h2-6,10H,1H3,(H,11,12);2-6,12H,1H3,(H,10,11) |
| InChIKey | FRSOWCIVOKKNJC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|