C28H47NO3 — CID 158122434
(6R)-6-[(3R,5S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-ethylhept-2-enamide (PubChem CID 158122434) has the molecular formula C28H47NO3 and a molecular weight of 445.69 g/mol. Its IUPAC name is (6R)-6-[(3R,5S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-ethylhept-2-enamide.
| Compound Name | (6R)-6-[(3R,5S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-ethylhept-2-enamide |
|---|---|
| PubChem CID | 158122434 |
| Molecular Formula | C28H47NO3 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.36 |
| IUPAC Name | (6R)-6-[(3R,5S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-ethylhept-2-enamide |
| SMILES | CCNC(=O)C=CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H47NO3/c1-5-29-25(32)9-7-6-8-18(2)21-10-11-22-26-23(13-15-28(21,22)4)27(3)14-12-20(30)16-19(27)17-24(26)31/h7,9,18-24,26,30-31H,5-6,8,10-17H2,1-4H3,(H,29,32)/t18-,19+,20-,21-,22+,23+,24?,26+,27+,28-/m1/s1 |
| InChIKey | SEUDVASTGXVRJE-AFFFAYHZSA-N |
| XLogP | 5.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|