C19H18F3N5O5 — CID 158123062
4-[2-(hydroxycarbamoyl)-4-nitrophenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 158123062) has the molecular formula C19H18F3N5O5 and a molecular weight of 453.38 g/mol. Its IUPAC name is 4-[2-(hydroxycarbamoyl)-4-nitrophenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[2-(hydroxycarbamoyl)-4-nitrophenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 158123062 |
| Molecular Formula | C19H18F3N5O5 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 4-[2-(hydroxycarbamoyl)-4-nitrophenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(NO)c1cc([N+](=O)[O-])ccc1N1CCN(C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H18F3N5O5/c20-19(21,22)12-2-1-3-13(10-12)23-18(29)26-8-6-25(7-9-26)16-5-4-14(27(31)32)11-15(16)17(28)24-30/h1-5,10-11,30H,6-9H2,(H,23,29)(H,24,28) |
| InChIKey | CVYBKCBOTQONPW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|