C22H39N5O5S — CID 158124815
3-(4-methoxybutyl)pyridine;N-(2-methoxyethyl)methanesulfonamide;2-methoxy-N-(pyrazin-2-ylmethyl)ethanamine (PubChem CID 158124815) has the molecular formula C22H39N5O5S and a molecular weight of 485.65 g/mol. Its IUPAC name is 3-(4-methoxybutyl)pyridine;N-(2-methoxyethyl)methanesulfonamide;2-methoxy-N-(pyrazin-2-ylmethyl)ethanamine.
| Compound Name | 3-(4-methoxybutyl)pyridine;N-(2-methoxyethyl)methanesulfonamide;2-methoxy-N-(pyrazin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 158124815 |
| Molecular Formula | C22H39N5O5S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 3-(4-methoxybutyl)pyridine;N-(2-methoxyethyl)methanesulfonamide;2-methoxy-N-(pyrazin-2-ylmethyl)ethanamine |
| SMILES | COCCCCc1cccnc1.COCCNCc1cnccn1.COCCNS(C)(=O)=O |
| InChI | InChI=1S/C10H15NO.C8H13N3O.C4H11NO3S/c1-12-8-3-2-5-10-6-4-7-11-9-10;1-12-5-4-10-7-8-6-9-2-3-11-8;1-8-4-3-5-9(2,6)7/h4,6-7,9H,2-3,5,8H2,1H3;2-3,6,10H,4-5,7H2,1H3;5H,3-4H2,1-2H3 |
| InChIKey | FSAPOJARAMJJIS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|