C28H34BrClN4O4 — CID 158127768
1-[3-bromo-4-chloro-1-(3-methoxypropyl)indazol-6-yl]ethanone;1-[1-(3-methoxypropyl)-3,4-dimethylindazol-6-yl]ethanone (PubChem CID 158127768) has the molecular formula C28H34BrClN4O4 and a molecular weight of 605.96 g/mol. Its IUPAC name is 1-[3-bromo-4-chloro-1-(3-methoxypropyl)indazol-6-yl]ethanone;1-[1-(3-methoxypropyl)-3,4-dimethylindazol-6-yl]ethanone.
| Compound Name | 1-[3-bromo-4-chloro-1-(3-methoxypropyl)indazol-6-yl]ethanone;1-[1-(3-methoxypropyl)-3,4-dimethylindazol-6-yl]ethanone |
|---|---|
| PubChem CID | 158127768 |
| Molecular Formula | C28H34BrClN4O4 |
| Molecular Weight | 605.96 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | 1-[3-bromo-4-chloro-1-(3-methoxypropyl)indazol-6-yl]ethanone;1-[1-(3-methoxypropyl)-3,4-dimethylindazol-6-yl]ethanone |
| SMILES | COCCCn1nc(Br)c2c(Cl)cc(C(C)=O)cc21.COCCCn1nc(C)c2c(C)cc(C(C)=O)cc21 |
| InChI | InChI=1S/C15H20N2O2.C13H14BrClN2O2/c1-10-8-13(12(3)18)9-14-15(10)11(2)16-17(14)6-5-7-19-4;1-8(18)9-6-10(15)12-11(7-9)17(16-13(12)14)4-3-5-19-2/h8-9H,5-7H2,1-4H3;6-7H,3-5H2,1-2H3 |
| InChIKey | FSJYPPUNMYSITC-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.96 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|