C12H15BrN6O6 — CID 158128591
[1-(2-bromoethyl)-3-nitropyrazol-5-yl]methanol;2-nitro-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine (PubChem CID 158128591) has the molecular formula C12H15BrN6O6 and a molecular weight of 419.19 g/mol. Its IUPAC name is [1-(2-bromoethyl)-3-nitropyrazol-5-yl]methanol;2-nitro-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine.
| Compound Name | [1-(2-bromoethyl)-3-nitropyrazol-5-yl]methanol;2-nitro-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 158128591 |
| Molecular Formula | C12H15BrN6O6 |
| Molecular Weight | 419.19 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | [1-(2-bromoethyl)-3-nitropyrazol-5-yl]methanol;2-nitro-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
| SMILES | O=[N+]([O-])c1cc(CO)n(CCBr)n1.O=[N+]([O-])c1cc2n(n1)CCOC2 |
| InChI | InChI=1S/C6H8BrN3O3.C6H7N3O3/c7-1-2-9-5(4-11)3-6(8-9)10(12)13;10-9(11)6-3-5-4-12-2-1-8(5)7-6/h3,11H,1-2,4H2;3H,1-2,4H2 |
| InChIKey | FSMJFBRBXQRVJO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 151.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|