C11H18N4O5 — CID 154660176
tert-butyl N-[2-[5-(hydroxymethyl)-3-nitropyrazol-1-yl]ethyl]carbamate (PubChem CID 154660176) has the molecular formula C11H18N4O5 and a molecular weight of 286.29 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(hydroxymethyl)-3-nitropyrazol-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(hydroxymethyl)-3-nitropyrazol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 154660176 |
| Molecular Formula | C11H18N4O5 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | tert-butyl N-[2-[5-(hydroxymethyl)-3-nitropyrazol-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1nc([N+](=O)[O-])cc1CO |
| InChI | InChI=1S/C11H18N4O5/c1-11(2,3)20-10(17)12-4-5-14-8(7-16)6-9(13-14)15(18)19/h6,16H,4-5,7H2,1-3H3,(H,12,17) |
| InChIKey | CSLOYTLPCCFRSI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|