C28H23FN4O3 — CID 158130047
2-acetyl-N-[3-(1-benzylpyrazol-4-yl)-2-fluorophenyl]-7-methoxyindolizine-1-carboxamide (PubChem CID 158130047) has the molecular formula C28H23FN4O3 and a molecular weight of 482.52 g/mol. Its IUPAC name is 2-acetyl-N-[3-(1-benzylpyrazol-4-yl)-2-fluorophenyl]-7-methoxyindolizine-1-carboxamide.
| Compound Name | 2-acetyl-N-[3-(1-benzylpyrazol-4-yl)-2-fluorophenyl]-7-methoxyindolizine-1-carboxamide |
|---|---|
| PubChem CID | 158130047 |
| Molecular Formula | C28H23FN4O3 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 2-acetyl-N-[3-(1-benzylpyrazol-4-yl)-2-fluorophenyl]-7-methoxyindolizine-1-carboxamide |
| SMILES | COc1ccn2cc(C(C)=O)c(C(=O)Nc3cccc(-c4cnn(Cc5ccccc5)c4)c3F)c2c1 |
| InChI | InChI=1S/C28H23FN4O3/c1-18(34)23-17-32-12-11-21(36-2)13-25(32)26(23)28(35)31-24-10-6-9-22(27(24)29)20-14-30-33(16-20)15-19-7-4-3-5-8-19/h3-14,16-17H,15H2,1-2H3,(H,31,35) |
| InChIKey | FSQVXPMMEQUXKT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |