C35H32Br2N4O2 — CID 158130155
3-(3-bromo-5-isocyano-6-methylindol-1-yl)cyclobutan-1-ol;3-bromo-5-isocyano-6-methyl-1-(3-phenylmethoxycyclobutyl)indole (PubChem CID 158130155) has the molecular formula C35H32Br2N4O2 and a molecular weight of 700.48 g/mol. Its IUPAC name is 3-(3-bromo-5-isocyano-6-methylindol-1-yl)cyclobutan-1-ol;3-bromo-5-isocyano-6-methyl-1-(3-phenylmethoxycyclobutyl)indole.
| Compound Name | 3-(3-bromo-5-isocyano-6-methylindol-1-yl)cyclobutan-1-ol;3-bromo-5-isocyano-6-methyl-1-(3-phenylmethoxycyclobutyl)indole |
|---|---|
| PubChem CID | 158130155 |
| Molecular Formula | C35H32Br2N4O2 |
| Molecular Weight | 700.48 g/mol |
| Exact Mass | 698.09 |
| IUPAC Name | 3-(3-bromo-5-isocyano-6-methylindol-1-yl)cyclobutan-1-ol;3-bromo-5-isocyano-6-methyl-1-(3-phenylmethoxycyclobutyl)indole |
| SMILES | [C-]#[N+]c1cc2c(Br)cn(C3CC(O)C3)c2cc1C.[C-]#[N+]c1cc2c(Br)cn(C3CC(OCc4ccccc4)C3)c2cc1C |
| InChI | InChI=1S/C21H19BrN2O.C14H13BrN2O/c1-14-8-21-18(11-20(14)23-2)19(22)12-24(21)16-9-17(10-16)25-13-15-6-4-3-5-7-15;1-8-3-14-11(6-13(8)16-2)12(15)7-17(14)9-4-10(18)5-9/h3-8,11-12,16-17H,9-10,13H2,1H3;3,6-7,9-10,18H,4-5H2,1H3 |
| InChIKey | FSRDLJVOCZCZMN-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.48 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|