C49H48N6O2 — CID 158601608
3-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclobutan-1-ol;3-[5-isocyano-6-methyl-1-(3-phenylmethoxycyclobutyl)indol-3-yl]-2-methylaniline (PubChem CID 158601608) has the molecular formula C49H48N6O2 and a molecular weight of 752.96 g/mol. Its IUPAC name is 3-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclobutan-1-ol;3-[5-isocyano-6-methyl-1-(3-phenylmethoxycyclobutyl)indol-3-yl]-2-methylaniline.
| Compound Name | 3-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclobutan-1-ol;3-[5-isocyano-6-methyl-1-(3-phenylmethoxycyclobutyl)indol-3-yl]-2-methylaniline |
|---|---|
| PubChem CID | 158601608 |
| Molecular Formula | C49H48N6O2 |
| Molecular Weight | 752.96 g/mol |
| Exact Mass | 752.38 |
| IUPAC Name | 3-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclobutan-1-ol;3-[5-isocyano-6-methyl-1-(3-phenylmethoxycyclobutyl)indol-3-yl]-2-methylaniline |
| SMILES | [C-]#[N+]c1cc2c(-c3cccc(N)c3C)cn(C3CC(O)C3)c2cc1C.[C-]#[N+]c1cc2c(-c3cccc(N)c3C)cn(C3CC(OCc4ccccc4)C3)c2cc1C |
| InChI | InChI=1S/C28H27N3O.C21H21N3O/c1-18-12-28-24(15-27(18)30-3)25(23-10-7-11-26(29)19(23)2)16-31(28)21-13-22(14-21)32-17-20-8-5-4-6-9-20;1-12-7-21-17(10-20(12)23-3)18(11-24(21)14-8-15(25)9-14)16-5-4-6-19(22)13(16)2/h4-12,15-16,21-22H,13-14,17,29H2,1-2H3;4-7,10-11,14-15,25H,8-9,22H2,1-2H3 |
| InChIKey | HVRXXJVNBCZKKB-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.96 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|