C39H36N2O8S3 — CID 158133431
2-[3-(benzenesulfonyl)-1H-indol-5-yl]ethanol;2-[3-(benzenesulfonyl)-1H-indol-5-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 158133431) has the molecular formula C39H36N2O8S3 and a molecular weight of 756.92 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)-1H-indol-5-yl]ethanol;2-[3-(benzenesulfonyl)-1H-indol-5-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[3-(benzenesulfonyl)-1H-indol-5-yl]ethanol;2-[3-(benzenesulfonyl)-1H-indol-5-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 158133431 |
| Molecular Formula | C39H36N2O8S3 |
| Molecular Weight | 756.92 g/mol |
| Exact Mass | 756.16 |
| IUPAC Name | 2-[3-(benzenesulfonyl)-1H-indol-5-yl]ethanol;2-[3-(benzenesulfonyl)-1H-indol-5-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2ccc3[nH]cc(S(=O)(=O)c4ccccc4)c3c2)cc1.O=S(=O)(c1ccccc1)c1c[nH]c2ccc(CCO)cc12 |
| InChI | InChI=1S/C23H21NO5S2.C16H15NO3S/c1-17-7-10-20(11-8-17)31(27,28)29-14-13-18-9-12-22-21(15-18)23(16-24-22)30(25,26)19-5-3-2-4-6-19;18-9-8-12-6-7-15-14(10-12)16(11-17-15)21(19,20)13-4-2-1-3-5-13/h2-12,15-16,24H,13-14H2,1H3;1-7,10-11,17-18H,8-9H2 |
| InChIKey | FTBCTIDXNMDOCJ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 163.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.92 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|