C23H20FNO5S2 — CID 58955117
2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 58955117) has the molecular formula C23H20FNO5S2 and a molecular weight of 473.55 g/mol. Its IUPAC name is 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58955117 |
| Molecular Formula | C23H20FNO5S2 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 2-[3-(3-fluorophenyl)sulfonyl-1H-indol-4-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2cccc3[nH]cc(S(=O)(=O)c4cccc(F)c4)c23)cc1 |
| InChI | InChI=1S/C23H20FNO5S2/c1-16-8-10-19(11-9-16)32(28,29)30-13-12-17-4-2-7-21-23(17)22(15-25-21)31(26,27)20-6-3-5-18(24)14-20/h2-11,14-15,25H,12-13H2,1H3 |
| InChIKey | HZDUYUUIAOIVTI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|